(2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid

C10H14N2O4 — CID 169025372

IUPAC(2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid
SMILESCOc1cc(C[C@H](N)C(=O)O)cnc1OC
InChIInChI=1S/C10H14N2O4/c1-15-8-4-6(3-7(11)10(13)14)5-12-9(8)16-2/h4-5,7H,3,11H2,1-2H3,(H,13,14)/t7-/m0/s1
InChIKeyDJTGWULFSMOTGX-ZETCQYMHSA-N
MW226.23 g/mol
LogP0.05
Rot. Bonds5

About (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid

(2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid (PubChem CID 169025372) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid.

Molecular Properties

Compound Name(2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid
PubChem CID169025372
Molecular FormulaC10H14N2O4
Molecular Weight226.23 g/mol
Exact Mass226.10
IUPAC Name(2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid
SMILESCOc1cc(C[C@H](N)C(=O)O)cnc1OC
InChIInChI=1S/C10H14N2O4/c1-15-8-4-6(3-7(11)10(13)14)5-12-9(8)16-2/h4-5,7H,3,11H2,1-2H3,(H,13,14)/t7-/m0/s1
InChIKeyDJTGWULFSMOTGX-ZETCQYMHSA-N
XLogP0.05
TPSA94.67 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.23
LogP ≤ 50.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid?
The IUPAC name of (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid (CID 169025372) is (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid.
What is the SMILES notation for (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid?
The canonical SMILES for (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid is COc1cc(C[C@H](N)C(=O)O)cnc1OC.
What is the InChIKey of (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid?
The InChIKey is DJTGWULFSMOTGX-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H14N2O4/c1-15-8-4-6(3-7(11)10(13)14)5-12-9(8)16-2/h4-5,7H,3,11H2,1-2H3,(H,13,14)/t7-/m0/s1.
What are the key properties of (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid?
(2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid has a molecular weight of 226.23 g/mol, XLogP of 0.05, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid is sourced from PubChem (CID 169025372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).