C10H14N2O4 — CID 169025372
(2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid (PubChem CID 169025372) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 169025372 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (2S)-2-amino-3-(5,6-dimethoxy-3-pyridinyl)propanoic acid |
| SMILES | COc1cc(C[C@H](N)C(=O)O)cnc1OC |
| InChI | InChI=1S/C10H14N2O4/c1-15-8-4-6(3-7(11)10(13)14)5-12-9(8)16-2/h4-5,7H,3,11H2,1-2H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | DJTGWULFSMOTGX-ZETCQYMHSA-N |
| XLogP | 0.05 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |