C11H18N4O — CID 178023722
5-[(E,4S)-4-aminohex-1-enyl]-4-methoxypyrimidin-2-amine (PubChem CID 178023722) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 5-[(E,4S)-4-aminohex-1-enyl]-4-methoxypyrimidin-2-amine.
| Compound Name | 5-[(E,4S)-4-aminohex-1-enyl]-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 178023722 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 5-[(E,4S)-4-aminohex-1-enyl]-4-methoxypyrimidin-2-amine |
| SMILES | CC[C@H](N)C/C=C/c1cnc(N)nc1OC |
| InChI | InChI=1S/C11H18N4O/c1-3-9(12)6-4-5-8-7-14-11(13)15-10(8)16-2/h4-5,7,9H,3,6,12H2,1-2H3,(H2,13,14,15)/b5-4+/t9-/m0/s1 |
| InChIKey | OLASXBWVCXFAMX-MOVJSRMASA-N |
| XLogP | 1.21 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |