C8H10ClN3S — CID 170478098
4-(3-amino-5-chloropyrazin-2-yl)but-3-ene-1-thiol (PubChem CID 170478098) has the molecular formula C8H10ClN3S and a molecular weight of 215.71 g/mol. Its IUPAC name is 4-(3-amino-5-chloropyrazin-2-yl)but-3-ene-1-thiol.
| Compound Name | 4-(3-amino-5-chloropyrazin-2-yl)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170478098 |
| Molecular Formula | C8H10ClN3S |
| Molecular Weight | 215.71 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 4-(3-amino-5-chloropyrazin-2-yl)but-3-ene-1-thiol |
| SMILES | Nc1nc(Cl)cnc1C=CCCS |
| InChI | InChI=1S/C8H10ClN3S/c9-7-5-11-6(8(10)12-7)3-1-2-4-13/h1,3,5,13H,2,4H2,(H2,10,12) |
| InChIKey | JMFHRMRPAUIMSR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.71 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|