C8H9Cl2N3 — CID 170498928
2-chloro-5-(4-chlorobut-1-enyl)pyrimidin-4-amine (PubChem CID 170498928) has the molecular formula C8H9Cl2N3 and a molecular weight of 218.09 g/mol. Its IUPAC name is 2-chloro-5-(4-chlorobut-1-enyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-5-(4-chlorobut-1-enyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 170498928 |
| Molecular Formula | C8H9Cl2N3 |
| Molecular Weight | 218.09 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 2-chloro-5-(4-chlorobut-1-enyl)pyrimidin-4-amine |
| SMILES | Nc1nc(Cl)ncc1C=CCCCl |
| InChI | InChI=1S/C8H9Cl2N3/c9-4-2-1-3-6-5-12-8(10)13-7(6)11/h1,3,5H,2,4H2,(H2,11,12,13) |
| InChIKey | VYWRFGZUQPZVRO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.09 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|