C7H9ClN4 — CID 169463378
5-(3-aminoprop-1-enyl)-2-chloropyrimidin-4-amine (PubChem CID 169463378) has the molecular formula C7H9ClN4 and a molecular weight of 184.63 g/mol. Its IUPAC name is 5-(3-aminoprop-1-enyl)-2-chloropyrimidin-4-amine.
| Compound Name | 5-(3-aminoprop-1-enyl)-2-chloropyrimidin-4-amine |
|---|---|
| PubChem CID | 169463378 |
| Molecular Formula | C7H9ClN4 |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 5-(3-aminoprop-1-enyl)-2-chloropyrimidin-4-amine |
| SMILES | NCC=Cc1cnc(Cl)nc1N |
| InChI | InChI=1S/C7H9ClN4/c8-7-11-4-5(2-1-3-9)6(10)12-7/h1-2,4H,3,9H2,(H2,10,11,12) |
| InChIKey | NWYOLOVWODPFMY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |