C8H11ClN4 — CID 169473384
2-chloro-5-[3-(methylamino)prop-1-enyl]pyrimidin-4-amine (PubChem CID 169473384) has the molecular formula C8H11ClN4 and a molecular weight of 198.66 g/mol. Its IUPAC name is 2-chloro-5-[3-(methylamino)prop-1-enyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-5-[3-(methylamino)prop-1-enyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 169473384 |
| Molecular Formula | C8H11ClN4 |
| Molecular Weight | 198.66 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-chloro-5-[3-(methylamino)prop-1-enyl]pyrimidin-4-amine |
| SMILES | CNCC=Cc1cnc(Cl)nc1N |
| InChI | InChI=1S/C8H11ClN4/c1-11-4-2-3-6-5-12-8(9)13-7(6)10/h2-3,5,11H,4H2,1H3,(H2,10,12,13) |
| InChIKey | IKRGWODBPACPSJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.66 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |