About 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine
6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine (PubChem CID 169473705) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine |
| PubChem CID | 169473705 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine |
| SMILES | CNCC=Cc1cc(N)c(N)nc1C |
| InChI | InChI=1S/C10H16N4/c1-7-8(4-3-5-13-2)6-9(11)10(12)14-7/h3-4,6,13H,5,11H2,1-2H3,(H2,12,14) |
| InChIKey | DQDVXGILXGPEMP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine?
The IUPAC name of 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine (CID 169473705) is 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine.
What is the SMILES notation for 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine?
The canonical SMILES for 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine is CNCC=Cc1cc(N)c(N)nc1C.
What is the InChIKey of 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine?
The InChIKey is DQDVXGILXGPEMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4/c1-7-8(4-3-5-13-2)6-9(11)10(12)14-7/h3-4,6,13H,5,11H2,1-2H3,(H2,12,14).
What are the key properties of 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine?
6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine has a molecular weight of 192.27 g/mol, XLogP of 0.79, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-[3-(methylamino)prop-1-enyl]pyridine-2,3-diamine is sourced from PubChem (CID 169473705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).