C12H18N2 — CID 169473623
2,4-dimethyl-6-[3-(methylamino)prop-1-enyl]aniline (PubChem CID 169473623) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 2,4-dimethyl-6-[3-(methylamino)prop-1-enyl]aniline.
| Compound Name | 2,4-dimethyl-6-[3-(methylamino)prop-1-enyl]aniline |
|---|---|
| PubChem CID | 169473623 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2,4-dimethyl-6-[3-(methylamino)prop-1-enyl]aniline |
| SMILES | CNCC=Cc1cc(C)cc(C)c1N |
| InChI | InChI=1S/C12H18N2/c1-9-7-10(2)12(13)11(8-9)5-4-6-14-3/h4-5,7-8,14H,6,13H2,1-3H3 |
| InChIKey | CEZZZXJFJQCCTL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|