C11H14N4 — CID 169461771
2-(3-azidoprop-1-enyl)-4,6-dimethylaniline (PubChem CID 169461771) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-(3-azidoprop-1-enyl)-4,6-dimethylaniline.
| Compound Name | 2-(3-azidoprop-1-enyl)-4,6-dimethylaniline |
|---|---|
| PubChem CID | 169461771 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-(3-azidoprop-1-enyl)-4,6-dimethylaniline |
| SMILES | Cc1cc(C)c(N)c(C=CCN=[N+]=[N-])c1 |
| InChI | InChI=1S/C11H14N4/c1-8-6-9(2)11(12)10(7-8)4-3-5-14-15-13/h3-4,6-7H,5,12H2,1-2H3 |
| InChIKey | CGOHJBOACWRGLQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|