C10H12N2O3 — CID 170476900
3-amino-5-(4-hydroxybut-1-enyl)pyridine-2-carboxylic acid (PubChem CID 170476900) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-amino-5-(4-hydroxybut-1-enyl)pyridine-2-carboxylic acid.
| Compound Name | 3-amino-5-(4-hydroxybut-1-enyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 170476900 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 3-amino-5-(4-hydroxybut-1-enyl)pyridine-2-carboxylic acid |
| SMILES | Nc1cc(C=CCCO)cnc1C(=O)O |
| InChI | InChI=1S/C10H12N2O3/c11-8-5-7(3-1-2-4-13)6-12-9(8)10(14)15/h1,3,5-6,13H,2,4,11H2,(H,14,15) |
| InChIKey | YWMFBBAUCFVTKW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |