C12H17N — CID 143996457
4-but-3-enyl-2,3,5-trimethylpyridine (PubChem CID 143996457) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 4-but-3-enyl-2,3,5-trimethylpyridine.
| Compound Name | 4-but-3-enyl-2,3,5-trimethylpyridine |
|---|---|
| PubChem CID | 143996457 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4-but-3-enyl-2,3,5-trimethylpyridine |
| SMILES | C=CCCc1c(C)cnc(C)c1C |
| InChI | InChI=1S/C12H17N/c1-5-6-7-12-9(2)8-13-11(4)10(12)3/h5,8H,1,6-7H2,2-4H3 |
| InChIKey | QGWOTMUZLIYDGS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|