C14H20 — CID 91804651
1-but-3-enyl-2,3,4,5-tetramethylbenzene (PubChem CID 91804651) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1-but-3-enyl-2,3,4,5-tetramethylbenzene.
| Compound Name | 1-but-3-enyl-2,3,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 91804651 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1-but-3-enyl-2,3,4,5-tetramethylbenzene |
| SMILES | C=CCCc1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C14H20/c1-6-7-8-14-9-10(2)11(3)12(4)13(14)5/h6,9H,1,7-8H2,2-5H3 |
| InChIKey | YQYFRLCDKBMZJU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|