C18H26 — CID 123413778
1,2,3,4-tetramethyl-5-oct-7-ynylbenzene (PubChem CID 123413778) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1,2,3,4-tetramethyl-5-oct-7-ynylbenzene.
| Compound Name | 1,2,3,4-tetramethyl-5-oct-7-ynylbenzene |
|---|---|
| PubChem CID | 123413778 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1,2,3,4-tetramethyl-5-oct-7-ynylbenzene |
| SMILES | C#CCCCCCCc1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C18H26/c1-6-7-8-9-10-11-12-18-13-14(2)15(3)16(4)17(18)5/h1,13H,7-12H2,2-5H3 |
| InChIKey | AJCHZOUHFJTBST-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|