C27H48 — CID 174103758
4-(5,5-dimethylhexyl)-1-(7,7-dimethyloctyl)-2,3,5-trimethylbenzene (PubChem CID 174103758) has the molecular formula C27H48 and a molecular weight of 372.68 g/mol. Its IUPAC name is 4-(5,5-dimethylhexyl)-1-(7,7-dimethyloctyl)-2,3,5-trimethylbenzene.
| Compound Name | 4-(5,5-dimethylhexyl)-1-(7,7-dimethyloctyl)-2,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 174103758 |
| Molecular Formula | C27H48 |
| Molecular Weight | 372.68 g/mol |
| Exact Mass | 372.38 |
| IUPAC Name | 4-(5,5-dimethylhexyl)-1-(7,7-dimethyloctyl)-2,3,5-trimethylbenzene |
| SMILES | Cc1cc(CCCCCCC(C)(C)C)c(C)c(C)c1CCCCC(C)(C)C |
| InChI | InChI=1S/C27H48/c1-21-20-24(16-12-10-11-14-18-26(4,5)6)22(2)23(3)25(21)17-13-15-19-27(7,8)9/h20H,10-19H2,1-9H3 |
| InChIKey | CHZUBYVLCUPVIO-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.68 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|