C27H46 — CID 164595096
2-(6,6-dimethylheptyl)-1,3,4-trimethyl-5-[5-(1-methylcyclopropyl)pentyl]benzene (PubChem CID 164595096) has the molecular formula C27H46 and a molecular weight of 370.67 g/mol. Its IUPAC name is 2-(6,6-dimethylheptyl)-1,3,4-trimethyl-5-[5-(1-methylcyclopropyl)pentyl]benzene.
| Compound Name | 2-(6,6-dimethylheptyl)-1,3,4-trimethyl-5-[5-(1-methylcyclopropyl)pentyl]benzene |
|---|---|
| PubChem CID | 164595096 |
| Molecular Formula | C27H46 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 370.36 |
| IUPAC Name | 2-(6,6-dimethylheptyl)-1,3,4-trimethyl-5-[5-(1-methylcyclopropyl)pentyl]benzene |
| SMILES | Cc1cc(CCCCCC2(C)CC2)c(C)c(C)c1CCCCCC(C)(C)C |
| InChI | InChI=1S/C27H46/c1-21-20-24(14-10-8-13-17-27(7)18-19-27)22(2)23(3)25(21)15-11-9-12-16-26(4,5)6/h20H,8-19H2,1-7H3 |
| InChIKey | YDEWTJVBSHZTGE-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|