C22H36O — CID 170103904
3-(5,5-dimethylhexyl)-4-[4-(1-methylcyclopropyl)butyl]phenol (PubChem CID 170103904) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is 3-(5,5-dimethylhexyl)-4-[4-(1-methylcyclopropyl)butyl]phenol.
| Compound Name | 3-(5,5-dimethylhexyl)-4-[4-(1-methylcyclopropyl)butyl]phenol |
|---|---|
| PubChem CID | 170103904 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | 3-(5,5-dimethylhexyl)-4-[4-(1-methylcyclopropyl)butyl]phenol |
| SMILES | CC(C)(C)CCCCc1cc(O)ccc1CCCCC1(C)CC1 |
| InChI | InChI=1S/C22H36O/c1-21(2,3)13-7-5-10-19-17-20(23)12-11-18(19)9-6-8-14-22(4)15-16-22/h11-12,17,23H,5-10,13-16H2,1-4H3 |
| InChIKey | JWNWVUOCVAEKBX-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|