C23H38O — CID 170103693
2-(5,5-dimethylhexyl)-4-[5-(1-methylcyclopropyl)pentyl]phenol (PubChem CID 170103693) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is 2-(5,5-dimethylhexyl)-4-[5-(1-methylcyclopropyl)pentyl]phenol.
| Compound Name | 2-(5,5-dimethylhexyl)-4-[5-(1-methylcyclopropyl)pentyl]phenol |
|---|---|
| PubChem CID | 170103693 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | 2-(5,5-dimethylhexyl)-4-[5-(1-methylcyclopropyl)pentyl]phenol |
| SMILES | CC(C)(C)CCCCc1cc(CCCCCC2(C)CC2)ccc1O |
| InChI | InChI=1S/C23H38O/c1-22(2,3)14-9-7-11-20-18-19(12-13-21(20)24)10-6-5-8-15-23(4)16-17-23/h12-13,18,24H,5-11,14-17H2,1-4H3 |
| InChIKey | NQBZIPDMWKTQCW-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|