C26H42O3 — CID 158464466
[1-[6-[3-(7,7-dimethyloctyl)-4-hydroxyphenyl]hexyl]cyclopropyl] formate (PubChem CID 158464466) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is [1-[6-[3-(7,7-dimethyloctyl)-4-hydroxyphenyl]hexyl]cyclopropyl] formate.
| Compound Name | [1-[6-[3-(7,7-dimethyloctyl)-4-hydroxyphenyl]hexyl]cyclopropyl] formate |
|---|---|
| PubChem CID | 158464466 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | [1-[6-[3-(7,7-dimethyloctyl)-4-hydroxyphenyl]hexyl]cyclopropyl] formate |
| SMILES | CC(C)(C)CCCCCCc1cc(CCCCCCC2(OC=O)CC2)ccc1O |
| InChI | InChI=1S/C26H42O3/c1-25(2,3)16-10-6-5-9-13-23-20-22(14-15-24(23)28)12-8-4-7-11-17-26(18-19-26)29-21-27/h14-15,20-21,28H,4-13,16-19H2,1-3H3 |
| InChIKey | CXQAWXOEODPSKP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|