C25H40O2 — CID 160999969
[1-[4-[3-(6,6-dimethylheptyl)-2,5-dimethylphenyl]butyl]cyclopropyl] formate (PubChem CID 160999969) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is [1-[4-[3-(6,6-dimethylheptyl)-2,5-dimethylphenyl]butyl]cyclopropyl] formate.
| Compound Name | [1-[4-[3-(6,6-dimethylheptyl)-2,5-dimethylphenyl]butyl]cyclopropyl] formate |
|---|---|
| PubChem CID | 160999969 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | [1-[4-[3-(6,6-dimethylheptyl)-2,5-dimethylphenyl]butyl]cyclopropyl] formate |
| SMILES | Cc1cc(CCCCCC(C)(C)C)c(C)c(CCCCC2(OC=O)CC2)c1 |
| InChI | InChI=1S/C25H40O2/c1-20-17-22(11-7-6-9-13-24(3,4)5)21(2)23(18-20)12-8-10-14-25(15-16-25)27-19-26/h17-19H,6-16H2,1-5H3 |
| InChIKey | HQKRKIXAJAESCA-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|