C26H42O2 — CID 159978702
[1-[5-[3-(6,6-dimethylheptyl)-4,5-dimethylphenyl]pentyl]cyclopropyl] formate (PubChem CID 159978702) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is [1-[5-[3-(6,6-dimethylheptyl)-4,5-dimethylphenyl]pentyl]cyclopropyl] formate.
| Compound Name | [1-[5-[3-(6,6-dimethylheptyl)-4,5-dimethylphenyl]pentyl]cyclopropyl] formate |
|---|---|
| PubChem CID | 159978702 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | [1-[5-[3-(6,6-dimethylheptyl)-4,5-dimethylphenyl]pentyl]cyclopropyl] formate |
| SMILES | Cc1cc(CCCCCC2(OC=O)CC2)cc(CCCCCC(C)(C)C)c1C |
| InChI | InChI=1S/C26H42O2/c1-21-18-23(12-8-6-11-15-26(16-17-26)28-20-27)19-24(22(21)2)13-9-7-10-14-25(3,4)5/h18-20H,6-17H2,1-5H3 |
| InChIKey | JPHSCAIQWZPTFP-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|