C26H42O2 — CID 159049236
[1-[4-[3-(6,6-dimethylheptyl)-2,4,5-trimethylphenyl]butyl]cyclopropyl] formate (PubChem CID 159049236) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is [1-[4-[3-(6,6-dimethylheptyl)-2,4,5-trimethylphenyl]butyl]cyclopropyl] formate.
| Compound Name | [1-[4-[3-(6,6-dimethylheptyl)-2,4,5-trimethylphenyl]butyl]cyclopropyl] formate |
|---|---|
| PubChem CID | 159049236 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | [1-[4-[3-(6,6-dimethylheptyl)-2,4,5-trimethylphenyl]butyl]cyclopropyl] formate |
| SMILES | Cc1cc(CCCCC2(OC=O)CC2)c(C)c(CCCCCC(C)(C)C)c1C |
| InChI | InChI=1S/C26H42O2/c1-20-18-23(12-9-11-15-26(16-17-26)28-19-27)22(3)24(21(20)2)13-8-7-10-14-25(4,5)6/h18-19H,7-17H2,1-6H3 |
| InChIKey | AGEICOYNWDIMQK-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|