C24H36O4 — CID 155770594
7-[4-[4-(1-formyloxycyclopropyl)butyl]-2-methylphenyl]-2,2-dimethylheptanoic acid (PubChem CID 155770594) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 7-[4-[4-(1-formyloxycyclopropyl)butyl]-2-methylphenyl]-2,2-dimethylheptanoic acid.
| Compound Name | 7-[4-[4-(1-formyloxycyclopropyl)butyl]-2-methylphenyl]-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 155770594 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 7-[4-[4-(1-formyloxycyclopropyl)butyl]-2-methylphenyl]-2,2-dimethylheptanoic acid |
| SMILES | Cc1cc(CCCCC2(OC=O)CC2)ccc1CCCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C24H36O4/c1-19-17-20(9-6-8-14-24(15-16-24)28-18-25)11-12-21(19)10-5-4-7-13-23(2,3)22(26)27/h11-12,17-18H,4-10,13-16H2,1-3H3,(H,26,27) |
| InChIKey | ATHLTCCCVXPENN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|