C23H34O4 — CID 155771066
7-[4-[4-(1-formyloxycyclopropyl)butyl]phenyl]-2,2-dimethylheptanoic acid (PubChem CID 155771066) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is 7-[4-[4-(1-formyloxycyclopropyl)butyl]phenyl]-2,2-dimethylheptanoic acid.
| Compound Name | 7-[4-[4-(1-formyloxycyclopropyl)butyl]phenyl]-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 155771066 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 7-[4-[4-(1-formyloxycyclopropyl)butyl]phenyl]-2,2-dimethylheptanoic acid |
| SMILES | CC(C)(CCCCCc1ccc(CCCCC2(OC=O)CC2)cc1)C(=O)O |
| InChI | InChI=1S/C23H34O4/c1-22(2,21(25)26)14-6-3-4-8-19-10-12-20(13-11-19)9-5-7-15-23(16-17-23)27-18-24/h10-13,18H,3-9,14-17H2,1-2H3,(H,25,26) |
| InChIKey | WPKILZHAQPOOON-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|