C24H38O3 — CID 162183015
[1-[5-[4-(6,6-dimethylheptyl)-3-hydroxyphenyl]pentyl]cyclopropyl] formate (PubChem CID 162183015) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is [1-[5-[4-(6,6-dimethylheptyl)-3-hydroxyphenyl]pentyl]cyclopropyl] formate.
| Compound Name | [1-[5-[4-(6,6-dimethylheptyl)-3-hydroxyphenyl]pentyl]cyclopropyl] formate |
|---|---|
| PubChem CID | 162183015 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | [1-[5-[4-(6,6-dimethylheptyl)-3-hydroxyphenyl]pentyl]cyclopropyl] formate |
| SMILES | CC(C)(C)CCCCCc1ccc(CCCCCC2(OC=O)CC2)cc1O |
| InChI | InChI=1S/C24H38O3/c1-23(2,3)14-8-5-7-11-21-13-12-20(18-22(21)26)10-6-4-9-15-24(16-17-24)27-19-25/h12-13,18-19,26H,4-11,14-17H2,1-3H3 |
| InChIKey | MIFWBIWIXFZCNS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|