C23H34O3 — CID 158625964
[1-[4-[4-hydroxy-3-[5-(1-methylcyclopropyl)pentyl]phenyl]butyl]cyclopropyl] formate (PubChem CID 158625964) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is [1-[4-[4-hydroxy-3-[5-(1-methylcyclopropyl)pentyl]phenyl]butyl]cyclopropyl] formate.
| Compound Name | [1-[4-[4-hydroxy-3-[5-(1-methylcyclopropyl)pentyl]phenyl]butyl]cyclopropyl] formate |
|---|---|
| PubChem CID | 158625964 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | [1-[4-[4-hydroxy-3-[5-(1-methylcyclopropyl)pentyl]phenyl]butyl]cyclopropyl] formate |
| SMILES | CC1(CCCCCc2cc(CCCCC3(OC=O)CC3)ccc2O)CC1 |
| InChI | InChI=1S/C23H34O3/c1-22(13-14-22)11-5-2-3-8-20-17-19(9-10-21(20)25)7-4-6-12-23(15-16-23)26-18-24/h9-10,17-18,25H,2-8,11-16H2,1H3 |
| InChIKey | QJYFTAKWTJNGAN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|