C25H38O2 — CID 158438013
[1-[4-[2,4-dimethyl-5-[5-(1-methylcyclopropyl)pentyl]phenyl]butyl]cyclopropyl] formate (PubChem CID 158438013) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is [1-[4-[2,4-dimethyl-5-[5-(1-methylcyclopropyl)pentyl]phenyl]butyl]cyclopropyl] formate.
| Compound Name | [1-[4-[2,4-dimethyl-5-[5-(1-methylcyclopropyl)pentyl]phenyl]butyl]cyclopropyl] formate |
|---|---|
| PubChem CID | 158438013 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | [1-[4-[2,4-dimethyl-5-[5-(1-methylcyclopropyl)pentyl]phenyl]butyl]cyclopropyl] formate |
| SMILES | Cc1cc(C)c(CCCCC2(OC=O)CC2)cc1CCCCCC1(C)CC1 |
| InChI | InChI=1S/C25H38O2/c1-20-17-21(2)23(10-6-8-12-25(15-16-25)27-19-26)18-22(20)9-5-4-7-11-24(3)13-14-24/h17-19H,4-16H2,1-3H3 |
| InChIKey | RWXOEWCTKUJXNA-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|