C27H40O4 — CID 155771138
1-[6-[3-[6-(1-formyloxycyclopropyl)hexyl]-4-methylphenyl]hexyl]cyclopropane-1-carboxylic acid (PubChem CID 155771138) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is 1-[6-[3-[6-(1-formyloxycyclopropyl)hexyl]-4-methylphenyl]hexyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[6-[3-[6-(1-formyloxycyclopropyl)hexyl]-4-methylphenyl]hexyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155771138 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 1-[6-[3-[6-(1-formyloxycyclopropyl)hexyl]-4-methylphenyl]hexyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1ccc(CCCCCCC2(C(=O)O)CC2)cc1CCCCCCC1(OC=O)CC1 |
| InChI | InChI=1S/C27H40O4/c1-22-12-13-23(10-6-2-4-8-14-26(16-17-26)25(29)30)20-24(22)11-7-3-5-9-15-27(18-19-27)31-21-28/h12-13,20-21H,2-11,14-19H2,1H3,(H,29,30) |
| InChIKey | UBRXOOOFPVEDJE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|