C25H36O4 — CID 155771097
1-[5-[4-[5-(1-formyloxycyclopropyl)pentyl]-3-methylphenyl]pentyl]cyclopropane-1-carboxylic acid (PubChem CID 155771097) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 1-[5-[4-[5-(1-formyloxycyclopropyl)pentyl]-3-methylphenyl]pentyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[5-[4-[5-(1-formyloxycyclopropyl)pentyl]-3-methylphenyl]pentyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155771097 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-[5-[4-[5-(1-formyloxycyclopropyl)pentyl]-3-methylphenyl]pentyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1cc(CCCCCC2(C(=O)O)CC2)ccc1CCCCCC1(OC=O)CC1 |
| InChI | InChI=1S/C25H36O4/c1-20-18-21(8-4-2-6-12-24(14-15-24)23(27)28)10-11-22(20)9-5-3-7-13-25(16-17-25)29-19-26/h10-11,18-19H,2-9,12-17H2,1H3,(H,27,28) |
| InChIKey | APGSERBEVDMEDU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|