C26H38O4 — CID 155770953
1-[6-[3-[4-(1-formyloxycyclopropyl)butyl]-2,4-dimethylphenyl]hexyl]cyclopropane-1-carboxylic acid (PubChem CID 155770953) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-[6-[3-[4-(1-formyloxycyclopropyl)butyl]-2,4-dimethylphenyl]hexyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[6-[3-[4-(1-formyloxycyclopropyl)butyl]-2,4-dimethylphenyl]hexyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155770953 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 1-[6-[3-[4-(1-formyloxycyclopropyl)butyl]-2,4-dimethylphenyl]hexyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1ccc(CCCCCCC2(C(=O)O)CC2)c(C)c1CCCCC1(OC=O)CC1 |
| InChI | InChI=1S/C26H38O4/c1-20-11-12-22(9-5-3-4-7-13-25(15-16-25)24(28)29)21(2)23(20)10-6-8-14-26(17-18-26)30-19-27/h11-12,19H,3-10,13-18H2,1-2H3,(H,28,29) |
| InChIKey | VFIRCEJRAFDSAX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|