C27H44O2 — CID 159987260
1-[5-[6-(7,7-dimethyloctyl)-2,3-dimethylphenyl]pentyl]cyclopropane-1-carboxylic acid (PubChem CID 159987260) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is 1-[5-[6-(7,7-dimethyloctyl)-2,3-dimethylphenyl]pentyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[5-[6-(7,7-dimethyloctyl)-2,3-dimethylphenyl]pentyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 159987260 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | 1-[5-[6-(7,7-dimethyloctyl)-2,3-dimethylphenyl]pentyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1ccc(CCCCCCC(C)(C)C)c(CCCCCC2(C(=O)O)CC2)c1C |
| InChI | InChI=1S/C27H44O2/c1-21-15-16-23(13-9-6-7-11-17-26(3,4)5)24(22(21)2)14-10-8-12-18-27(19-20-27)25(28)29/h15-16H,6-14,17-20H2,1-5H3,(H,28,29) |
| InChIKey | IWNFNOIQYMZFGL-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|