C29H46O4 — CID 155771094
1-[6-[2-(7-carboxy-7-methyloctyl)-3,4,6-trimethylphenyl]hexyl]cyclopropane-1-carboxylic acid (PubChem CID 155771094) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is 1-[6-[2-(7-carboxy-7-methyloctyl)-3,4,6-trimethylphenyl]hexyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[6-[2-(7-carboxy-7-methyloctyl)-3,4,6-trimethylphenyl]hexyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155771094 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | 1-[6-[2-(7-carboxy-7-methyloctyl)-3,4,6-trimethylphenyl]hexyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1cc(C)c(CCCCCCC2(C(=O)O)CC2)c(CCCCCCC(C)(C)C(=O)O)c1C |
| InChI | InChI=1S/C29H46O4/c1-21-20-22(2)24(14-10-7-9-13-17-29(18-19-29)27(32)33)25(23(21)3)15-11-6-8-12-16-28(4,5)26(30)31/h20H,6-19H2,1-5H3,(H,30,31)(H,32,33) |
| InChIKey | QVPBBSPRYXKZNE-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|