C24H36O6 — CID 155771263
1-[5-[2-(6-carboxy-6-methylheptyl)-3,5-dihydroxyphenyl]pentyl]cyclopropane-1-carboxylic acid (PubChem CID 155771263) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-[5-[2-(6-carboxy-6-methylheptyl)-3,5-dihydroxyphenyl]pentyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[5-[2-(6-carboxy-6-methylheptyl)-3,5-dihydroxyphenyl]pentyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155771263 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 1-[5-[2-(6-carboxy-6-methylheptyl)-3,5-dihydroxyphenyl]pentyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(C)(CCCCCc1c(O)cc(O)cc1CCCCCC1(C(=O)O)CC1)C(=O)O |
| InChI | InChI=1S/C24H36O6/c1-23(2,21(27)28)11-7-4-6-10-19-17(15-18(25)16-20(19)26)9-5-3-8-12-24(13-14-24)22(29)30/h15-16,25-26H,3-14H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | NKWOGBXLSBPVCZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|