C23H38O4 — CID 157114914
7-[2-(5,5-dimethylhexyl)-4,6-dihydroxyphenyl]-2,2-dimethylheptanoic acid (PubChem CID 157114914) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is 7-[2-(5,5-dimethylhexyl)-4,6-dihydroxyphenyl]-2,2-dimethylheptanoic acid.
| Compound Name | 7-[2-(5,5-dimethylhexyl)-4,6-dihydroxyphenyl]-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 157114914 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 7-[2-(5,5-dimethylhexyl)-4,6-dihydroxyphenyl]-2,2-dimethylheptanoic acid |
| SMILES | CC(C)(C)CCCCc1cc(O)cc(O)c1CCCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C23H38O4/c1-22(2,3)13-10-8-11-17-15-18(24)16-20(25)19(17)12-7-6-9-14-23(4,5)21(26)27/h15-16,24-25H,6-14H2,1-5H3,(H,26,27) |
| InChIKey | AVQPOEDIOQLGGK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|