C27H46O2 — CID 158756383
7-[2-(7,7-dimethyloctyl)-3,6-dimethylphenyl]-2,2-dimethylheptanoic acid (PubChem CID 158756383) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is 7-[2-(7,7-dimethyloctyl)-3,6-dimethylphenyl]-2,2-dimethylheptanoic acid.
| Compound Name | 7-[2-(7,7-dimethyloctyl)-3,6-dimethylphenyl]-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 158756383 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | 7-[2-(7,7-dimethyloctyl)-3,6-dimethylphenyl]-2,2-dimethylheptanoic acid |
| SMILES | Cc1ccc(C)c(CCCCCC(C)(C)C(=O)O)c1CCCCCCC(C)(C)C |
| InChI | InChI=1S/C27H46O2/c1-21-17-18-22(2)24(16-12-10-14-20-27(6,7)25(28)29)23(21)15-11-8-9-13-19-26(3,4)5/h17-18H,8-16,19-20H2,1-7H3,(H,28,29) |
| InChIKey | VCSHEPVDWHPYIL-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|