C25H40O3 — CID 164594943
7-[4-(6,6-dimethyl-7-oxooctyl)phenyl]-2,2-dimethylheptanoic acid (PubChem CID 164594943) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is 7-[4-(6,6-dimethyl-7-oxooctyl)phenyl]-2,2-dimethylheptanoic acid.
| Compound Name | 7-[4-(6,6-dimethyl-7-oxooctyl)phenyl]-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 164594943 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 7-[4-(6,6-dimethyl-7-oxooctyl)phenyl]-2,2-dimethylheptanoic acid |
| SMILES | CC(=O)C(C)(C)CCCCCc1ccc(CCCCCC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C25H40O3/c1-20(26)24(2,3)18-10-6-8-12-21-14-16-22(17-15-21)13-9-7-11-19-25(4,5)23(27)28/h14-17H,6-13,18-19H2,1-5H3,(H,27,28) |
| InChIKey | ZHTOBSZTMVVXEG-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|