C23H36O2 — CID 170139606
2,2-dimethyl-7-[4-[4-(1-methylcyclopropyl)butyl]phenyl]heptanoic acid (PubChem CID 170139606) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is 2,2-dimethyl-7-[4-[4-(1-methylcyclopropyl)butyl]phenyl]heptanoic acid.
| Compound Name | 2,2-dimethyl-7-[4-[4-(1-methylcyclopropyl)butyl]phenyl]heptanoic acid |
|---|---|
| PubChem CID | 170139606 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 2,2-dimethyl-7-[4-[4-(1-methylcyclopropyl)butyl]phenyl]heptanoic acid |
| SMILES | CC1(CCCCc2ccc(CCCCCC(C)(C)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C23H36O2/c1-22(2,21(24)25)15-7-4-5-9-19-11-13-20(14-12-19)10-6-8-16-23(3)17-18-23/h11-14H,4-10,15-18H2,1-3H3,(H,24,25) |
| InChIKey | NTLMAGXHBBBRSU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|