C24H38O2 — CID 170139630
2,2-dimethyl-7-[4-[5-(1-methylcyclopropyl)pentyl]phenyl]heptanoic acid (PubChem CID 170139630) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is 2,2-dimethyl-7-[4-[5-(1-methylcyclopropyl)pentyl]phenyl]heptanoic acid.
| Compound Name | 2,2-dimethyl-7-[4-[5-(1-methylcyclopropyl)pentyl]phenyl]heptanoic acid |
|---|---|
| PubChem CID | 170139630 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | 2,2-dimethyl-7-[4-[5-(1-methylcyclopropyl)pentyl]phenyl]heptanoic acid |
| SMILES | CC1(CCCCCc2ccc(CCCCCC(C)(C)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C24H38O2/c1-23(2,22(25)26)16-8-4-6-10-20-12-14-21(15-13-20)11-7-5-9-17-24(3)18-19-24/h12-15H,4-11,16-19H2,1-3H3,(H,25,26) |
| InChIKey | MPUQQYHXDHHCPC-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|