C27H44O3 — CID 164594987
8-[2-(7,7-dimethyl-8-oxononyl)phenyl]-2,2-dimethyloctanoic acid (PubChem CID 164594987) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is 8-[2-(7,7-dimethyl-8-oxononyl)phenyl]-2,2-dimethyloctanoic acid.
| Compound Name | 8-[2-(7,7-dimethyl-8-oxononyl)phenyl]-2,2-dimethyloctanoic acid |
|---|---|
| PubChem CID | 164594987 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | 8-[2-(7,7-dimethyl-8-oxononyl)phenyl]-2,2-dimethyloctanoic acid |
| SMILES | CC(=O)C(C)(C)CCCCCCc1ccccc1CCCCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C27H44O3/c1-22(28)26(2,3)20-14-8-6-10-16-23-18-12-13-19-24(23)17-11-7-9-15-21-27(4,5)25(29)30/h12-13,18-19H,6-11,14-17,20-21H2,1-5H3,(H,29,30) |
| InChIKey | HKDQWSLERVNSAP-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|