C20H30O2 — CID 175871242
5-[2-(4-cyclopropylbutyl)phenyl]-2,2-dimethylpentanoic acid (PubChem CID 175871242) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 5-[2-(4-cyclopropylbutyl)phenyl]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[2-(4-cyclopropylbutyl)phenyl]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 175871242 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 5-[2-(4-cyclopropylbutyl)phenyl]-2,2-dimethylpentanoic acid |
| SMILES | CC(C)(CCCc1ccccc1CCCCC1CC1)C(=O)O |
| InChI | InChI=1S/C20H30O2/c1-20(2,19(21)22)15-7-12-18-11-6-5-10-17(18)9-4-3-8-16-13-14-16/h5-6,10-11,16H,3-4,7-9,12-15H2,1-2H3,(H,21,22) |
| InChIKey | ZJRJFZLOQISBEW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|