C20H32O2 — CID 157308896
5-[2-(4,4-dimethylpentyl)phenyl]-2,2-dimethylpentanoic acid (PubChem CID 157308896) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 5-[2-(4,4-dimethylpentyl)phenyl]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[2-(4,4-dimethylpentyl)phenyl]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 157308896 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 5-[2-(4,4-dimethylpentyl)phenyl]-2,2-dimethylpentanoic acid |
| SMILES | CC(C)(C)CCCc1ccccc1CCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C20H32O2/c1-19(2,3)14-8-12-16-10-6-7-11-17(16)13-9-15-20(4,5)18(21)22/h6-7,10-11H,8-9,12-15H2,1-5H3,(H,21,22) |
| InChIKey | SJXMKVYJNLHRMG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |