C22H34O6 — CID 155596302
6-[5-(5-carboxy-5-methylhexyl)-2,4-dihydroxyphenyl]-2,2-dimethylhexanoic acid (PubChem CID 155596302) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is 6-[5-(5-carboxy-5-methylhexyl)-2,4-dihydroxyphenyl]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[5-(5-carboxy-5-methylhexyl)-2,4-dihydroxyphenyl]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 155596302 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 6-[5-(5-carboxy-5-methylhexyl)-2,4-dihydroxyphenyl]-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCCc1cc(CCCCC(C)(C)C(=O)O)c(O)cc1O)C(=O)O |
| InChI | InChI=1S/C22H34O6/c1-21(2,19(25)26)11-7-5-9-15-13-16(18(24)14-17(15)23)10-6-8-12-22(3,4)20(27)28/h13-14,23-24H,5-12H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | ZGDDKSAMUAPEEV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|