C29H48O4 — CID 155596473
8-[5-(7-carboxy-7-methyloctyl)-2,3,4-trimethylphenyl]-2,2-dimethyloctanoic acid (PubChem CID 155596473) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is 8-[5-(7-carboxy-7-methyloctyl)-2,3,4-trimethylphenyl]-2,2-dimethyloctanoic acid.
| Compound Name | 8-[5-(7-carboxy-7-methyloctyl)-2,3,4-trimethylphenyl]-2,2-dimethyloctanoic acid |
|---|---|
| PubChem CID | 155596473 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | 8-[5-(7-carboxy-7-methyloctyl)-2,3,4-trimethylphenyl]-2,2-dimethyloctanoic acid |
| SMILES | Cc1c(CCCCCCC(C)(C)C(=O)O)cc(CCCCCCC(C)(C)C(=O)O)c(C)c1C |
| InChI | InChI=1S/C29H48O4/c1-21-22(2)24(16-12-8-10-14-18-28(4,5)26(30)31)20-25(23(21)3)17-13-9-11-15-19-29(6,7)27(32)33/h20H,8-19H2,1-7H3,(H,30,31)(H,32,33) |
| InChIKey | QUXGBCGITINZHY-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|