C26H42O4 — CID 155771077
7-[4-(5-formyloxy-5-methylhexyl)-2,3,6-trimethylphenyl]-2,2-dimethylheptanoic acid (PubChem CID 155771077) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is 7-[4-(5-formyloxy-5-methylhexyl)-2,3,6-trimethylphenyl]-2,2-dimethylheptanoic acid.
| Compound Name | 7-[4-(5-formyloxy-5-methylhexyl)-2,3,6-trimethylphenyl]-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 155771077 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | 7-[4-(5-formyloxy-5-methylhexyl)-2,3,6-trimethylphenyl]-2,2-dimethylheptanoic acid |
| SMILES | Cc1cc(CCCCC(C)(C)OC=O)c(C)c(C)c1CCCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C26H42O4/c1-19-17-22(13-10-12-16-26(6,7)30-18-27)20(2)21(3)23(19)14-9-8-11-15-25(4,5)24(28)29/h17-18H,8-16H2,1-7H3,(H,28,29) |
| InChIKey | WDJSPDJHUXOOQZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|