C25H40O4 — CID 155771154
7-[5-(5-formyloxy-5-methylhexyl)-2,3-dimethylphenyl]-2,2-dimethylheptanoic acid (PubChem CID 155771154) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is 7-[5-(5-formyloxy-5-methylhexyl)-2,3-dimethylphenyl]-2,2-dimethylheptanoic acid.
| Compound Name | 7-[5-(5-formyloxy-5-methylhexyl)-2,3-dimethylphenyl]-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 155771154 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 7-[5-(5-formyloxy-5-methylhexyl)-2,3-dimethylphenyl]-2,2-dimethylheptanoic acid |
| SMILES | Cc1cc(CCCCC(C)(C)OC=O)cc(CCCCCC(C)(C)C(=O)O)c1C |
| InChI | InChI=1S/C25H40O4/c1-19-16-21(12-9-11-15-25(5,6)29-18-26)17-22(20(19)2)13-8-7-10-14-24(3,4)23(27)28/h16-18H,7-15H2,1-6H3,(H,27,28) |
| InChIKey | MGCMXUKHMZINQV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|