C26H42O5 — CID 155770960
8-[3-(7-formyloxy-7-methyloctyl)-2-hydroxyphenyl]-2,2-dimethyloctanoic acid (PubChem CID 155770960) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is 8-[3-(7-formyloxy-7-methyloctyl)-2-hydroxyphenyl]-2,2-dimethyloctanoic acid.
| Compound Name | 8-[3-(7-formyloxy-7-methyloctyl)-2-hydroxyphenyl]-2,2-dimethyloctanoic acid |
|---|---|
| PubChem CID | 155770960 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 8-[3-(7-formyloxy-7-methyloctyl)-2-hydroxyphenyl]-2,2-dimethyloctanoic acid |
| SMILES | CC(C)(CCCCCCc1cccc(CCCCCCC(C)(C)C(=O)O)c1O)OC=O |
| InChI | InChI=1S/C26H42O5/c1-25(2,24(29)30)18-11-7-5-9-14-21-16-13-17-22(23(21)28)15-10-6-8-12-19-26(3,4)31-20-27/h13,16-17,20,28H,5-12,14-15,18-19H2,1-4H3,(H,29,30) |
| InChIKey | VMOIQMWWBLQKBK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|