C24H38O5 — CID 155770864
7-[3-(6-formyloxy-6-methylheptyl)-2-hydroxyphenyl]-2,2-dimethylheptanoic acid (PubChem CID 155770864) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is 7-[3-(6-formyloxy-6-methylheptyl)-2-hydroxyphenyl]-2,2-dimethylheptanoic acid.
| Compound Name | 7-[3-(6-formyloxy-6-methylheptyl)-2-hydroxyphenyl]-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 155770864 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 7-[3-(6-formyloxy-6-methylheptyl)-2-hydroxyphenyl]-2,2-dimethylheptanoic acid |
| SMILES | CC(C)(CCCCCc1cccc(CCCCCC(C)(C)C(=O)O)c1O)OC=O |
| InChI | InChI=1S/C24H38O5/c1-23(2,22(27)28)16-9-5-7-12-19-14-11-15-20(21(19)26)13-8-6-10-17-24(3,4)29-18-25/h11,14-15,18,26H,5-10,12-13,16-17H2,1-4H3,(H,27,28) |
| InChIKey | DWWICVZYKJKARZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|