C22H34O2 — CID 166652827
6-[2-(5-cyclopropylpentyl)phenyl]-2,2-dimethylhexanoic acid (PubChem CID 166652827) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is 6-[2-(5-cyclopropylpentyl)phenyl]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[2-(5-cyclopropylpentyl)phenyl]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 166652827 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 6-[2-(5-cyclopropylpentyl)phenyl]-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCCc1ccccc1CCCCCC1CC1)C(=O)O |
| InChI | InChI=1S/C22H34O2/c1-22(2,21(23)24)17-9-8-14-20-13-7-6-12-19(20)11-5-3-4-10-18-15-16-18/h6-7,12-13,18H,3-5,8-11,14-17H2,1-2H3,(H,23,24) |
| InChIKey | KXPGUVKKWQSNFW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|