C25H42O2 — CID 157342637
[6-[5-(7,7-dimethyloctyl)-2-methylphenyl]-2-methylhexan-2-yl] formate (PubChem CID 157342637) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is [6-[5-(7,7-dimethyloctyl)-2-methylphenyl]-2-methylhexan-2-yl] formate.
| Compound Name | [6-[5-(7,7-dimethyloctyl)-2-methylphenyl]-2-methylhexan-2-yl] formate |
|---|---|
| PubChem CID | 157342637 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | [6-[5-(7,7-dimethyloctyl)-2-methylphenyl]-2-methylhexan-2-yl] formate |
| SMILES | Cc1ccc(CCCCCCC(C)(C)C)cc1CCCCC(C)(C)OC=O |
| InChI | InChI=1S/C25H42O2/c1-21-15-16-22(13-9-7-8-11-17-24(2,3)4)19-23(21)14-10-12-18-25(5,6)27-20-26/h15-16,19-20H,7-14,17-18H2,1-6H3 |
| InChIKey | IOIQACFEPOYENQ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|