C24H38O2 — CID 160681983
[1-[4-[3-(6,6-dimethylheptyl)-4-methylphenyl]butyl]cyclopropyl] formate (PubChem CID 160681983) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is [1-[4-[3-(6,6-dimethylheptyl)-4-methylphenyl]butyl]cyclopropyl] formate.
| Compound Name | [1-[4-[3-(6,6-dimethylheptyl)-4-methylphenyl]butyl]cyclopropyl] formate |
|---|---|
| PubChem CID | 160681983 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | [1-[4-[3-(6,6-dimethylheptyl)-4-methylphenyl]butyl]cyclopropyl] formate |
| SMILES | Cc1ccc(CCCCC2(OC=O)CC2)cc1CCCCCC(C)(C)C |
| InChI | InChI=1S/C24H38O2/c1-20-12-13-21(10-7-9-15-24(16-17-24)26-19-25)18-22(20)11-6-5-8-14-23(2,3)4/h12-13,18-19H,5-11,14-17H2,1-4H3 |
| InChIKey | WXASUBZPRBMMLG-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|