C20H32O4 — CID 160996760
[5-[5-(4,4-dimethylpentyl)-2,3-dihydroxyphenyl]-2-methylpentan-2-yl] formate (PubChem CID 160996760) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is [5-[5-(4,4-dimethylpentyl)-2,3-dihydroxyphenyl]-2-methylpentan-2-yl] formate.
| Compound Name | [5-[5-(4,4-dimethylpentyl)-2,3-dihydroxyphenyl]-2-methylpentan-2-yl] formate |
|---|---|
| PubChem CID | 160996760 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | [5-[5-(4,4-dimethylpentyl)-2,3-dihydroxyphenyl]-2-methylpentan-2-yl] formate |
| SMILES | CC(C)(C)CCCc1cc(O)c(O)c(CCCC(C)(C)OC=O)c1 |
| InChI | InChI=1S/C20H32O4/c1-19(2,3)10-6-8-15-12-16(18(23)17(22)13-15)9-7-11-20(4,5)24-14-21/h12-14,22-23H,6-11H2,1-5H3 |
| InChIKey | AWJJOTVGKOUKEF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|